C15H19N5O2 — CID 109364829
N-(2-methoxyethyl)-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109364829) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364829 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-6-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(NCc2ccccn2)nc(C)n1 |
| InChI | InChI=1S/C15H19N5O2/c1-11-19-13(15(21)17-7-8-22-2)9-14(20-11)18-10-12-5-3-4-6-16-12/h3-6,9H,7-8,10H2,1-2H3,(H,17,21)(H,18,19,20) |
| InChIKey | QATMGIKEGJAOCZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|