C16H17N2O4S+ — CID 10936489
6-benzyl-8-(2,3-dihydroxypropyl)-7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-5-one (PubChem CID 10936489) has the molecular formula C16H17N2O4S+ and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-benzyl-8-(2,3-dihydroxypropyl)-7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-5-one.
| Compound Name | 6-benzyl-8-(2,3-dihydroxypropyl)-7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-5-one |
|---|---|
| PubChem CID | 10936489 |
| Molecular Formula | C16H17N2O4S+ |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6-benzyl-8-(2,3-dihydroxypropyl)-7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-5-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)[n+](CC(O)CO)c2sccn12 |
| InChI | InChI=1S/C16H16N2O4S/c19-10-12(20)9-18-15(22)13(8-11-4-2-1-3-5-11)14(21)17-6-7-23-16(17)18/h1-7,12,19-20H,8-10H2/p+1 |
| InChIKey | RHOFYRNCOFIZQN-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|