C20H27N5O2 — CID 109364946
N-(2-methoxyethyl)-2-methyl-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109364946) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-methyl-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364946 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(Nc2ccc(N3CCCCC3)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H27N5O2/c1-15-22-18(20(26)21-10-13-27-2)14-19(23-15)24-16-6-8-17(9-7-16)25-11-4-3-5-12-25/h6-9,14H,3-5,10-13H2,1-2H3,(H,21,26)(H,22,23,24) |
| InChIKey | AQYKHTYCQNVJGQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|