C16H28O3S2 — CID 10936509
(Z,4S)-4-methoxy-3-methyl-5-[(8S,11R)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]pent-2-en-1-ol (PubChem CID 10936509) has the molecular formula C16H28O3S2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (Z,4S)-4-methoxy-3-methyl-5-[(8S,11R)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]pent-2-en-1-ol.
| Compound Name | (Z,4S)-4-methoxy-3-methyl-5-[(8S,11R)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 10936509 |
| Molecular Formula | C16H28O3S2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (Z,4S)-4-methoxy-3-methyl-5-[(8S,11R)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]pent-2-en-1-ol |
| SMILES | CO[C@@H](C[C@@H]1CC[C@@H](C)C2(O1)SCCCS2)/C(C)=C\CO |
| InChI | InChI=1S/C16H28O3S2/c1-12(7-8-17)15(18-3)11-14-6-5-13(2)16(19-14)20-9-4-10-21-16/h7,13-15,17H,4-6,8-11H2,1-3H3/b12-7-/t13-,14+,15+/m1/s1 |
| InChIKey | LWGOZIOFWCUXAL-ZRNYOZAESA-N |
| XLogP | 3.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|