C18H23NO5 — CID 10936528
(2S,3S,4S)-3-(2-hydroxyethyl)-1-phenylmethoxycarbonyl-4-prop-1-en-2-ylpyrrolidine-2-carboxylic acid (PubChem CID 10936528) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (2S,3S,4S)-3-(2-hydroxyethyl)-1-phenylmethoxycarbonyl-4-prop-1-en-2-ylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-3-(2-hydroxyethyl)-1-phenylmethoxycarbonyl-4-prop-1-en-2-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10936528 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2S,3S,4S)-3-(2-hydroxyethyl)-1-phenylmethoxycarbonyl-4-prop-1-en-2-ylpyrrolidine-2-carboxylic acid |
| SMILES | C=C(C)[C@H]1CN(C(=O)OCc2ccccc2)[C@H](C(=O)O)[C@H]1CCO |
| InChI | InChI=1S/C18H23NO5/c1-12(2)15-10-19(16(17(21)22)14(15)8-9-20)18(23)24-11-13-6-4-3-5-7-13/h3-7,14-16,20H,1,8-11H2,2H3,(H,21,22)/t14-,15+,16-/m0/s1 |
| InChIKey | JNHUHCYHYQSRGA-XHSDSOJGSA-N |
| XLogP | 2.28 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|