C17H19ClN4O2 — CID 109365353
N-[(4-chlorophenyl)methyl]-2-methyl-6-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 109365353) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-methyl-6-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-methyl-6-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109365353 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-methyl-6-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCc2ccc(Cl)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-12-20-15(10-16(21-12)22-6-8-24-9-7-22)17(23)19-11-13-2-4-14(18)5-3-13/h2-5,10H,6-9,11H2,1H3,(H,19,23) |
| InChIKey | NRBDXEBXFXPVJO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |