About 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine
6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine (PubChem CID 10936656) has the molecular formula C15H13BrN2
and a molecular weight of 301.19 g/mol. Its IUPAC name is 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine.
Molecular Properties
| Compound Name | 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine |
| PubChem CID | 10936656 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine |
| SMILES | NC1=NC(c2ccccc2)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H13BrN2/c16-12-6-7-13-11(8-12)9-14(18-15(13)17)10-4-2-1-3-5-10/h1-8,14H,9H2,(H2,17,18) |
| InChIKey | ISNQNGVISJCDEL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine?
The IUPAC name of 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine (CID 10936656) is 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine.
What is the SMILES notation for 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine?
The canonical SMILES for 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine is NC1=NC(c2ccccc2)Cc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine?
The InChIKey is ISNQNGVISJCDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2/c16-12-6-7-13-11(8-12)9-14(18-15(13)17)10-4-2-1-3-5-10/h1-8,14H,9H2,(H2,17,18).
What are the key properties of 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine?
6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine has a molecular weight of 301.19 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-phenyl-3,4-dihydroisoquinolin-1-amine is sourced from PubChem (CID 10936656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).