C21H30N6O2 — CID 109366826
N-[3-(dimethylamino)propyl]-2-methyl-6-(2-morpholin-4-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109366826) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-methyl-6-(2-morpholin-4-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-methyl-6-(2-morpholin-4-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366826 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-methyl-6-(2-morpholin-4-ylanilino)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccccc2N2CCOCC2)cc(C(=O)NCCCN(C)C)n1 |
| InChI | InChI=1S/C21H30N6O2/c1-16-23-18(21(28)22-9-6-10-26(2)3)15-20(24-16)25-17-7-4-5-8-19(17)27-11-13-29-14-12-27/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,22,28)(H,23,24,25) |
| InChIKey | KFMQMFMDMWLYGJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|