C17H20FN5O — CID 109366981
N-(3-fluorophenyl)-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidine-4-carboxamide (PubChem CID 109366981) has the molecular formula C17H20FN5O and a molecular weight of 329.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366981 |
| Molecular Formula | C17H20FN5O |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(3-fluorophenyl)-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc(F)c2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C17H20FN5O/c1-12-19-15(17(24)21-14-5-3-4-13(18)10-14)11-16(20-12)23-8-6-22(2)7-9-23/h3-5,10-11H,6-9H2,1-2H3,(H,21,24) |
| InChIKey | MIBPRUHMMFHCIL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |