C18H26Cl2Si — CID 10936760
dichloro-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 10936760) has the molecular formula C18H26Cl2Si and a molecular weight of 341.40 g/mol. Its IUPAC name is dichloro-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dichloro-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 10936760 |
| Molecular Formula | C18H26Cl2Si |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | dichloro-bis(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](Cl)(Cl)C2C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C18H26Cl2Si/c1-9-10(2)14(6)17(13(9)5)21(19,20)18-15(7)11(3)12(4)16(18)8/h17-18H,1-8H3 |
| InChIKey | AOQJZPDSXBJADH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|