C22H30O3 — CID 10936808
(2E,4E,6Z)-7-[2-methoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 10936808) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2E,4E,6Z)-7-[2-methoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-[2-methoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10936808 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2E,4E,6Z)-7-[2-methoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | COc1c(/C(C)=C\C=C\C(C)=C\C(=O)O)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H30O3/c1-14(2)18-12-19(15(3)4)22(25-7)20(13-18)17(6)10-8-9-16(5)11-21(23)24/h8-15H,1-7H3,(H,23,24)/b9-8+,16-11+,17-10- |
| InChIKey | LPWCYKDBURUOIZ-HNBVHFCESA-N |
| XLogP | 5.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|