C20H25FN4O — CID 109369876
6-(2-ethylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109369876) has the molecular formula C20H25FN4O and a molecular weight of 356.45 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(2-ethylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109369876 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | CCC1CCCCN1c1cc(C(=O)NCc2ccc(F)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H25FN4O/c1-3-17-6-4-5-11-25(17)19-12-18(23-14(2)24-19)20(26)22-13-15-7-9-16(21)10-8-15/h7-10,12,17H,3-6,11,13H2,1-2H3,(H,22,26) |
| InChIKey | OJIUACDVEOTEBF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |