C8H8FN5O4S3 — CID 10937101
5-[(4-amino-3-fluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 10937101) has the molecular formula C8H8FN5O4S3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-[(4-amino-3-fluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(4-amino-3-fluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10937101 |
| Molecular Formula | C8H8FN5O4S3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 5-[(4-amino-3-fluorophenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nnc(S(N)(=O)=O)s2)cc1F |
| InChI | InChI=1S/C8H8FN5O4S3/c9-5-3-4(1-2-6(5)10)21(17,18)14-7-12-13-8(19-7)20(11,15)16/h1-3H,10H2,(H,12,14)(H2,11,15,16) |
| InChIKey | JZSYDIHQPGCMDN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|