C20H19N5O2 — CID 109371046
N-(3-acetylphenyl)-2-methyl-6-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109371046) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-methyl-6-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-methyl-6-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109371046 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-methyl-6-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cc(NCc3cccnc3)nc(C)n2)c1 |
| InChI | InChI=1S/C20H19N5O2/c1-13(26)16-6-3-7-17(9-16)25-20(27)18-10-19(24-14(2)23-18)22-12-15-5-4-8-21-11-15/h3-11H,12H2,1-2H3,(H,25,27)(H,22,23,24) |
| InChIKey | PEOWDHLBTJSVLK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |