C21H21ClN4O2 — CID 109371506
N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(2-phenylethylamino)pyrimidine-4-carboxamide (PubChem CID 109371506) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(2-phenylethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(2-phenylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109371506 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(2-phenylethylamino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cc(NCCc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-14-24-18(21(27)26-17-12-16(22)8-9-19(17)28-2)13-20(25-14)23-11-10-15-6-4-3-5-7-15/h3-9,12-13H,10-11H2,1-2H3,(H,26,27)(H,23,24,25) |
| InChIKey | OARJDIVJMVUHDO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |