C22H24FN5O — CID 109371990
6-[4-(dimethylamino)anilino]-N-[2-(4-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109371990) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is 6-[4-(dimethylamino)anilino]-N-[2-(4-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[4-(dimethylamino)anilino]-N-[2-(4-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109371990 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 6-[4-(dimethylamino)anilino]-N-[2-(4-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccc(N(C)C)cc2)cc(C(=O)NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H24FN5O/c1-15-25-20(22(29)24-13-12-16-4-6-17(23)7-5-16)14-21(26-15)27-18-8-10-19(11-9-18)28(2)3/h4-11,14H,12-13H2,1-3H3,(H,24,29)(H,25,26,27) |
| InChIKey | HFIQUYRDONSYQH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|