C18H16N2O4 — CID 1093725
N-(3,4-dimethoxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 1093725) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 1093725 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3ccccc3)on2)cc1OC |
| InChI | InChI=1S/C18H16N2O4/c1-22-15-9-8-13(10-17(15)23-2)19-18(21)14-11-16(24-20-14)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,19,21) |
| InChIKey | DXRBPXGFRWFDEY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |