C19H18N2O5 — CID 1093729
5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 1093729) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 1093729 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(-c3ccccc3)on2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18N2O5/c1-23-16-9-13(10-17(24-2)18(16)25-3)20-19(22)14-11-15(26-21-14)12-7-5-4-6-8-12/h4-11H,1-3H3,(H,20,22) |
| InChIKey | YVJWNMLCMJMAHN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |