C22H25N5O — CID 109373956
6-(cycloheptylamino)-2-methyl-N-quinolin-8-ylpyrimidine-4-carboxamide (PubChem CID 109373956) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 6-(cycloheptylamino)-2-methyl-N-quinolin-8-ylpyrimidine-4-carboxamide.
| Compound Name | 6-(cycloheptylamino)-2-methyl-N-quinolin-8-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109373956 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 6-(cycloheptylamino)-2-methyl-N-quinolin-8-ylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC2CCCCCC2)cc(C(=O)Nc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C22H25N5O/c1-15-24-19(14-20(25-15)26-17-10-4-2-3-5-11-17)22(28)27-18-12-6-8-16-9-7-13-23-21(16)18/h6-9,12-14,17H,2-5,10-11H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | KLQUUNHXRXGTCG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |