C12H14F3NO3 — CID 109374404
(NZ)-N-[1-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethylidene]hydroxylamine (PubChem CID 109374404) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is (NZ)-N-[1-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 109374404 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (NZ)-N-[1-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1ccccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO3/c1-9(16-17)10-4-2-3-5-11(10)19-7-6-18-8-12(13,14)15/h2-5,17H,6-8H2,1H3/b16-9- |
| InChIKey | SPTJTWWNNBCXHI-SXGWCWSVSA-N |
| XLogP | 2.84 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|