About 5-butoxy-N'-hydroxypentanimidamide
5-butoxy-N'-hydroxypentanimidamide (PubChem CID 109374755) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-butoxy-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 5-butoxy-N'-hydroxypentanimidamide |
| PubChem CID | 109374755 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 5-butoxy-N'-hydroxypentanimidamide |
| SMILES | CCCCOCCCC/C(N)=N/O |
| InChI | InChI=1S/C9H20N2O2/c1-2-3-7-13-8-5-4-6-9(10)11-12/h12H,2-8H2,1H3,(H2,10,11) |
| InChIKey | HOOASQLTZVHXKZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-N'-hydroxypentanimidamide?
The IUPAC name of 5-butoxy-N'-hydroxypentanimidamide (CID 109374755) is 5-butoxy-N'-hydroxypentanimidamide.
What is the SMILES notation for 5-butoxy-N'-hydroxypentanimidamide?
The canonical SMILES for 5-butoxy-N'-hydroxypentanimidamide is CCCCOCCCC/C(N)=N/O.
What is the InChIKey of 5-butoxy-N'-hydroxypentanimidamide?
The InChIKey is HOOASQLTZVHXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-2-3-7-13-8-5-4-6-9(10)11-12/h12H,2-8H2,1H3,(H2,10,11).
What are the key properties of 5-butoxy-N'-hydroxypentanimidamide?
5-butoxy-N'-hydroxypentanimidamide has a molecular weight of 188.27 g/mol, XLogP of 1.72, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-N'-hydroxypentanimidamide is sourced from PubChem (CID 109374755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).