C20H36O4Si — CID 10937501
(2'S,4'aR,8'R)-8'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol (PubChem CID 10937501) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (2'S,4'aR,8'R)-8'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol.
| Compound Name | (2'S,4'aR,8'R)-8'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol |
|---|---|
| PubChem CID | 10937501 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2'S,4'aR,8'R)-8'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4'a-methylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-2'-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC2(OCCO2)[C@]2(C)CC[C@H](O)C=C12 |
| InChI | InChI=1S/C20H36O4Si/c1-18(2,3)25(5,6)24-14-15-7-10-20(22-11-12-23-20)19(4)9-8-16(21)13-17(15)19/h13,15-16,21H,7-12,14H2,1-6H3/t15-,16-,19+/m0/s1 |
| InChIKey | IJALIODCVJNPLX-TXPKVOOTSA-N |
| XLogP | 4.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|