C23H30O4 — CID 10937547
ethyl (7S,7aR)-7,7a-dimethyl-2-(2-phenylmethoxyacetyl)-3,3a,6,7-tetrahydro-1H-indene-2-carboxylate (PubChem CID 10937547) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethyl (7S,7aR)-7,7a-dimethyl-2-(2-phenylmethoxyacetyl)-3,3a,6,7-tetrahydro-1H-indene-2-carboxylate.
| Compound Name | ethyl (7S,7aR)-7,7a-dimethyl-2-(2-phenylmethoxyacetyl)-3,3a,6,7-tetrahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 10937547 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | ethyl (7S,7aR)-7,7a-dimethyl-2-(2-phenylmethoxyacetyl)-3,3a,6,7-tetrahydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)COCc2ccccc2)CC2C=CC[C@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C23H30O4/c1-4-27-21(25)23(13-19-12-8-9-17(2)22(19,3)16-23)20(24)15-26-14-18-10-6-5-7-11-18/h5-8,10-12,17,19H,4,9,13-16H2,1-3H3/t17-,19?,22+,23?/m0/s1 |
| InChIKey | HKAGLXVKHCLSLG-KALYMBDESA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|