C14H17FO4 — CID 109375524
(E)-3-[3-fluoro-4-(3-methoxypropoxymethyl)phenyl]prop-2-enoic acid (PubChem CID 109375524) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-(3-methoxypropoxymethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-(3-methoxypropoxymethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375524 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (E)-3-[3-fluoro-4-(3-methoxypropoxymethyl)phenyl]prop-2-enoic acid |
| SMILES | COCCCOCc1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H17FO4/c1-18-7-2-8-19-10-12-5-3-11(9-13(12)15)4-6-14(16)17/h3-6,9H,2,7-8,10H2,1H3,(H,16,17)/b6-4+ |
| InChIKey | JPSBKOWHWQIWGI-GQCTYLIASA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|