C8H17N3O2S — CID 109375800
N'-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)butanimidamide (PubChem CID 109375800) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is N'-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)butanimidamide.
| Compound Name | N'-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)butanimidamide |
|---|---|
| PubChem CID | 109375800 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N'-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)butanimidamide |
| SMILES | CC(C/C(N)=N/O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C8H17N3O2S/c1-7(6-8(9)10-12)11-2-4-14(13)5-3-11/h7,12H,2-6H2,1H3,(H2,9,10) |
| InChIKey | IBZSRHIMKNAOAN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|