C18H28O4S2 — CID 10937600
(4R,5S)-4-[bis(ethylsulfanyl)methyl]-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10937600) has the molecular formula C18H28O4S2 and a molecular weight of 372.55 g/mol. Its IUPAC name is (4R,5S)-4-[bis(ethylsulfanyl)methyl]-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[bis(ethylsulfanyl)methyl]-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10937600 |
| Molecular Formula | C18H28O4S2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (4R,5S)-4-[bis(ethylsulfanyl)methyl]-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCSC(SCC)[C@@H]1OC(C)(C)O[C@H]1COc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28O4S2/c1-6-23-17(24-7-2)16-15(21-18(3,4)22-16)12-20-14-10-8-13(19-5)9-11-14/h8-11,15-17H,6-7,12H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | VWGGOCSYYYXZAQ-JKSUJKDBSA-N |
| XLogP | 4.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|