C24H36OS — CID 10937603
(6R)-6-[(1R,7aR)-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol (PubChem CID 10937603) has the molecular formula C24H36OS and a molecular weight of 372.62 g/mol. Its IUPAC name is (6R)-6-[(1R,7aR)-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,7aR)-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 10937603 |
| Molecular Formula | C24H36OS |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (6R)-6-[(1R,7aR)-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CCC2=C(Sc3ccccc3)CCC[C@@]21C |
| InChI | InChI=1S/C24H36OS/c1-18(10-8-16-23(2,3)25)20-14-15-21-22(13-9-17-24(20,21)4)26-19-11-6-5-7-12-19/h5-7,11-12,18,20,25H,8-10,13-17H2,1-4H3/t18-,20-,24-/m1/s1 |
| InChIKey | OZISYFYHBQPRRN-DRMXPCRNSA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |