C27H30N4O2 — CID 109376043
1-ethyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-2-[(4-phenylmethoxyphenyl)methyl]guanidine (PubChem CID 109376043) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-ethyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-2-[(4-phenylmethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-2-[(4-phenylmethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 109376043 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-ethyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-2-[(4-phenylmethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCc2ccccc2)cc1)NCC1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C27H30N4O2/c1-2-28-27(30-18-22-16-26(32)31-25-11-7-6-10-24(22)25)29-17-20-12-14-23(15-13-20)33-19-21-8-4-3-5-9-21/h3-15,22H,2,16-19H2,1H3,(H,31,32)(H2,28,29,30) |
| InChIKey | PTOZLBWVVXMRIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|