C21H37F3N6O — CID 109376061
N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376061) has the molecular formula C21H37F3N6O and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376061 |
| Molecular Formula | C21H37F3N6O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCN(C(=O)C2CCCC2)CC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H37F3N6O/c1-17(21(22,23)24)28-13-15-30(16-14-28)20(25-2)26-7-8-27-9-11-29(12-10-27)19(31)18-5-3-4-6-18/h17-18H,3-16H2,1-2H3,(H,25,26) |
| InChIKey | BIUAGUPUUPXKKU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|