C17H29F3N4 — CID 109376095
N-(2,2-dicyclopropylethyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376095) has the molecular formula C17H29F3N4 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(2,2-dicyclopropylethyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-(2,2-dicyclopropylethyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376095 |
| Molecular Formula | C17H29F3N4 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-(2,2-dicyclopropylethyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C1CC1)C1CC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H29F3N4/c1-12(17(18,19)20)23-7-9-24(10-8-23)16(21-2)22-11-15(13-3-4-13)14-5-6-14/h12-15H,3-11H2,1-2H3,(H,21,22) |
| InChIKey | CCAFCOXENBCFKK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|