C16H32F3N5 — CID 109376181
N-[2-[butan-2-yl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376181) has the molecular formula C16H32F3N5 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-[butan-2-yl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376181 |
| Molecular Formula | C16H32F3N5 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | N-[2-[butan-2-yl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCC(C)N(C)CCN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H32F3N5/c1-6-13(2)22(5)8-7-21-15(20-4)24-11-9-23(10-12-24)14(3)16(17,18)19/h13-14H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | MHJSWVOZMWJBSX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|