C16H30F3N5O — CID 109376195
2,2-dimethyl-N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]propanamide (PubChem CID 109376195) has the molecular formula C16H30F3N5O and a molecular weight of 365.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 109376195 |
| Molecular Formula | C16H30F3N5O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H30F3N5O/c1-12(16(17,18)19)23-8-10-24(11-9-23)14(20-5)22-7-6-21-13(25)15(2,3)4/h12H,6-11H2,1-5H3,(H,20,22)(H,21,25) |
| InChIKey | VXPKYPSUJJZHPW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|