C18H37F3IN5 — CID 109376248
N-[7-(dimethylamino)heptyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376248) has the molecular formula C18H37F3IN5 and a molecular weight of 507.43 g/mol. Its IUPAC name is N-[7-(dimethylamino)heptyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[7-(dimethylamino)heptyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376248 |
| Molecular Formula | C18H37F3IN5 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-[7-(dimethylamino)heptyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCCCCN(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H36F3N5.HI/c1-16(18(19,20)21)25-12-14-26(15-13-25)17(22-2)23-10-8-6-5-7-9-11-24(3)4;/h16H,5-15H2,1-4H3,(H,22,23);1H |
| InChIKey | NDFWKEZOWYSOCG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|