C16H24F6IN5S — CID 109376286
N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376286) has the molecular formula C16H24F6IN5S and a molecular weight of 559.36 g/mol. Its IUPAC name is N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376286 |
| Molecular Formula | C16H24F6IN5S |
| Molecular Weight | 559.36 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H23F6N5S.HI/c1-3-23-14(24-5-4-13-25-12(10-28-13)16(20,21)22)27-8-6-26(7-9-27)11(2)15(17,18)19;/h10-11H,3-9H2,1-2H3,(H,23,24);1H |
| InChIKey | XTSAGHUTCRZULH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|