C16H29F3IN7 — CID 109376296
N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376296) has the molecular formula C16H29F3IN7 and a molecular weight of 503.36 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376296 |
| Molecular Formula | C16H29F3IN7 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H28F3N7.HI/c1-4-14-23-22-12-26(14)7-6-21-15(20-5-2)25-10-8-24(9-11-25)13(3)16(17,18)19;/h12-13H,4-11H2,1-3H3,(H,20,21);1H |
| InChIKey | PEYAYCXQNBKNIC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|