C13H23F6IN4 — CID 109376304
N-ethyl-4-(1,1,1-trifluoropropan-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376304) has the molecular formula C13H23F6IN4 and a molecular weight of 476.25 g/mol. Its IUPAC name is N-ethyl-4-(1,1,1-trifluoropropan-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1,1,1-trifluoropropan-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376304 |
| Molecular Formula | C13H23F6IN4 |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-ethyl-4-(1,1,1-trifluoropropan-2-yl)-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C13H22F6N4.HI/c1-3-20-11(21-5-4-12(14,15)16)23-8-6-22(7-9-23)10(2)13(17,18)19;/h10H,3-9H2,1-2H3,(H,20,21);1H |
| InChIKey | XRNPMJAMGIYCBH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|