C18H34F3IN4O2 — CID 109376340
N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376340) has the molecular formula C18H34F3IN4O2 and a molecular weight of 522.39 g/mol. Its IUPAC name is N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376340 |
| Molecular Formula | C18H34F3IN4O2 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H33F3N4O2.HI/c1-3-22-17(23-7-5-12-26-14-16-6-4-13-27-16)25-10-8-24(9-11-25)15(2)18(19,20)21;/h15-16H,3-14H2,1-2H3,(H,22,23);1H |
| InChIKey | JOJWNDSRUJFXSH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|