C18H33F3N4O2 — CID 109376341
N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376341) has the molecular formula C18H33F3N4O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376341 |
| Molecular Formula | C18H33F3N4O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H33F3N4O2/c1-3-22-17(23-7-5-12-26-14-16-6-4-13-27-16)25-10-8-24(9-11-25)15(2)18(19,20)21/h15-16H,3-14H2,1-2H3,(H,22,23) |
| InChIKey | FGQDNHWEMDLRCB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|