C15H29F3IN5O — CID 109376348
3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 109376348) has the molecular formula C15H29F3IN5O and a molecular weight of 479.33 g/mol. Its IUPAC name is 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109376348 |
| Molecular Formula | C15H29F3IN5O |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H28F3N5O.HI/c1-5-19-14(20-7-6-13(24)21(3)4)23-10-8-22(9-11-23)12(2)15(16,17)18;/h12H,5-11H2,1-4H3,(H,19,20);1H |
| InChIKey | VKXPHBFAACWHAG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|