C19H36F3IN6O2 — CID 109376456
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide (PubChem CID 109376456) has the molecular formula C19H36F3IN6O2 and a molecular weight of 564.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109376456 |
| Molecular Formula | C19H36F3IN6O2 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(N1CCN(/C(=N/CC(=O)N(C)C)NCCCN2CCOCC2)CC1)C(F)(F)F.I |
| InChI | InChI=1S/C19H35F3N6O2.HI/c1-16(19(20,21)22)27-7-9-28(10-8-27)18(24-15-17(29)25(2)3)23-5-4-6-26-11-13-30-14-12-26;/h16H,4-15H2,1-3H3,(H,23,24);1H |
| InChIKey | YABMKNTVMYAOFR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|