C14H28F3IN4 — CID 109376458
N-ethyl-N'-(2-methylpropyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376458) has the molecular formula C14H28F3IN4 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-ethyl-N'-(2-methylpropyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-methylpropyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376458 |
| Molecular Formula | C14H28F3IN4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-ethyl-N'-(2-methylpropyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C14H27F3N4.HI/c1-5-18-13(19-10-11(2)3)21-8-6-20(7-9-21)12(4)14(15,16)17;/h11-12H,5-10H2,1-4H3,(H,18,19);1H |
| InChIKey | JGKUNRQRQCPADV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|