C16H29F3N4O3S — CID 109376535
N'-methyl-N-[(4-methylsulfonyloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376535) has the molecular formula C16H29F3N4O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is N'-methyl-N-[(4-methylsulfonyloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methylsulfonyloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376535 |
| Molecular Formula | C16H29F3N4O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N'-methyl-N-[(4-methylsulfonyloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(S(C)(=O)=O)CCOCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H29F3N4O3S/c1-13(16(17,18)19)22-6-8-23(9-7-22)14(20-2)21-12-15(27(3,24)25)4-10-26-11-5-15/h13H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | YCVJOKCYUPMYJI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|