C14H26F3N5O2 — CID 109376561
N-(2-methoxyethyl)-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]acetamide (PubChem CID 109376561) has the molecular formula C14H26F3N5O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109376561 |
| Molecular Formula | C14H26F3N5O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N5O2/c1-11(14(15,16)17)21-5-7-22(8-6-21)13(18-2)20-10-12(23)19-4-9-24-3/h11H,4-10H2,1-3H3,(H,18,20)(H,19,23) |
| InChIKey | XONRJAXEEZTKJK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|