C14H24F6N4O — CID 109376723
N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376723) has the molecular formula C14H24F6N4O and a molecular weight of 378.36 g/mol. Its IUPAC name is N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376723 |
| Molecular Formula | C14H24F6N4O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F6N4O/c1-11(14(18,19)20)23-5-7-24(8-6-23)12(21-2)22-4-3-9-25-10-13(15,16)17/h11H,3-10H2,1-2H3,(H,21,22) |
| InChIKey | PTZOITUEHMJSFO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|