C16H32F3N5O2S — CID 109376777
N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376777) has the molecular formula C16H32F3N5O2S and a molecular weight of 415.53 g/mol. Its IUPAC name is N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376777 |
| Molecular Formula | C16H32F3N5O2S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H32F3N5O2S/c1-5-20-15(21-8-13-27(25,26)24(6-2)7-3)23-11-9-22(10-12-23)14(4)16(17,18)19/h14H,5-13H2,1-4H3,(H,20,21) |
| InChIKey | WNQXMDZJELPDBK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|