C16H29F3N4O — CID 109376831
N-ethyl-N'-[2-(oxolan-2-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376831) has the molecular formula C16H29F3N4O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-ethyl-N'-[2-(oxolan-2-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(oxolan-2-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376831 |
| Molecular Formula | C16H29F3N4O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | N-ethyl-N'-[2-(oxolan-2-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1CCCO1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H29F3N4O/c1-3-20-15(21-7-6-14-5-4-12-24-14)23-10-8-22(9-11-23)13(2)16(17,18)19/h13-14H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | GYDXDEWVLIPJKH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|