C16H31F3IN5O — CID 109376954
2-[[(butan-2-ylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 109376954) has the molecular formula C16H31F3IN5O and a molecular weight of 493.36 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(butan-2-ylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109376954 |
| Molecular Formula | C16H31F3IN5O |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H30F3N5O.HI/c1-6-12(2)21-15(20-11-14(25)22(4)5)24-9-7-23(8-10-24)13(3)16(17,18)19;/h12-13H,6-11H2,1-5H3,(H,20,21);1H |
| InChIKey | RPBYQHBJUMFOTL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|