C13H25F3N4O — CID 109376957
N-ethyl-N'-(2-methoxyethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376957) has the molecular formula C13H25F3N4O and a molecular weight of 310.36 g/mol. Its IUPAC name is N-ethyl-N'-(2-methoxyethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-methoxyethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376957 |
| Molecular Formula | C13H25F3N4O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-ethyl-N'-(2-methoxyethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCOC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N4O/c1-4-17-12(18-5-10-21-3)20-8-6-19(7-9-20)11(2)13(14,15)16/h11H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | DBUOPODZWSYTKO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|