C22H35F3IN5O — CID 109377028
N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377028) has the molecular formula C22H35F3IN5O and a molecular weight of 569.45 g/mol. Its IUPAC name is N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377028 |
| Molecular Formula | C22H35F3IN5O |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCC(O)CC2)cc1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C22H34F3N5O.HI/c1-17(22(23,24)25)29-11-13-30(14-12-29)21(26-2)27-15-18-3-5-19(6-4-18)16-28-9-7-20(31)8-10-28;/h3-6,17,20,31H,7-16H2,1-2H3,(H,26,27);1H |
| InChIKey | FAIGQYRXFMXSND-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|