C16H31F3N4O — CID 109377069
N'-methyl-N-[3-(2-methylpropoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377069) has the molecular formula C16H31F3N4O and a molecular weight of 352.45 g/mol. Its IUPAC name is N'-methyl-N-[3-(2-methylpropoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[3-(2-methylpropoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377069 |
| Molecular Formula | C16H31F3N4O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N'-methyl-N-[3-(2-methylpropoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCOCC(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H31F3N4O/c1-13(2)12-24-11-5-6-21-15(20-4)23-9-7-22(8-10-23)14(3)16(17,18)19/h13-14H,5-12H2,1-4H3,(H,20,21) |
| InChIKey | ZRSRJZYZRLWFMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|